C12H13NO3S2 — CID 91113962
3-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-1,3-thiazole-2-thione (PubChem CID 91113962) has the molecular formula C12H13NO3S2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 3-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-1,3-thiazole-2-thione.
| Compound Name | 3-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 91113962 |
| Molecular Formula | C12H13NO3S2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.03 |
| IUPAC Name | 3-[(3,4-dimethoxyphenyl)methyl]-4-hydroxy-1,3-thiazole-2-thione |
| SMILES | COc1ccc(Cn2c(O)csc2=S)cc1OC |
| InChI | InChI=1S/C12H13NO3S2/c1-15-9-4-3-8(5-10(9)16-2)6-13-11(14)7-18-12(13)17/h3-5,7,14H,6H2,1-2H3 |
| InChIKey | AASXKGSXCBXIBD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 43.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|