C18H17NOS2 — CID 130209668
3-benzyl-4-(2-methoxy-5-methylphenyl)-1,3-thiazole-2-thione (PubChem CID 130209668) has the molecular formula C18H17NOS2 and a molecular weight of 327.47 g/mol. Its IUPAC name is 3-benzyl-4-(2-methoxy-5-methylphenyl)-1,3-thiazole-2-thione.
| Compound Name | 3-benzyl-4-(2-methoxy-5-methylphenyl)-1,3-thiazole-2-thione |
|---|---|
| PubChem CID | 130209668 |
| Molecular Formula | C18H17NOS2 |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.08 |
| IUPAC Name | 3-benzyl-4-(2-methoxy-5-methylphenyl)-1,3-thiazole-2-thione |
| SMILES | COc1ccc(C)cc1-c1csc(=S)n1Cc1ccccc1 |
| InChI | InChI=1S/C18H17NOS2/c1-13-8-9-17(20-2)15(10-13)16-12-22-18(21)19(16)11-14-6-4-3-5-7-14/h3-10,12H,11H2,1-2H3 |
| InChIKey | TWEVJXPZAXIWTA-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|