C13H17N5O — CID 106791089
4-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 106791089) has the molecular formula C13H17N5O and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 4-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106791089 |
| Molecular Formula | C13H17N5O |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | 4-[(3,5-dimethyl-1,2,4-triazol-1-yl)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Cn2nc(C)nc2C)cc1OC |
| InChI | InChI=1S/C13H17N5O/c1-8-16-9(2)18(17-8)7-10-4-5-11(13(14)15)12(6-10)19-3/h4-6H,7H2,1-3H3,(H3,14,15) |
| InChIKey | WHKGRJRYKQHUOO-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 89.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|