C12H14N4OS2 — CID 106792003
2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]benzenecarboximidamide (PubChem CID 106792003) has the molecular formula C12H14N4OS2 and a molecular weight of 294.41 g/mol. Its IUPAC name is 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]benzenecarboximidamide.
| Compound Name | 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 106792003 |
| Molecular Formula | C12H14N4OS2 |
| Molecular Weight | 294.41 g/mol |
| Exact Mass | 294.06 |
| IUPAC Name | 2-methoxy-4-[(3-methyl-1,2,4-thiadiazol-5-yl)sulfanylmethyl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2nc(C)ns2)cc1OC |
| InChI | InChI=1S/C12H14N4OS2/c1-7-15-12(19-16-7)18-6-8-3-4-9(11(13)14)10(5-8)17-2/h3-5H,6H2,1-2H3,(H3,13,14) |
| InChIKey | ZQOWQMWHCMEDQC-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.41 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|