C15H15ClN2OS — CID 106791862
4-[(4-chlorophenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide (PubChem CID 106791862) has the molecular formula C15H15ClN2OS and a molecular weight of 306.82 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 4-[(4-chlorophenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106791862 |
| Molecular Formula | C15H15ClN2OS |
| Molecular Weight | 306.82 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | 4-[(4-chlorophenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CSc2ccc(Cl)cc2)cc1OC |
| InChI | InChI=1S/C15H15ClN2OS/c1-19-14-8-10(2-7-13(14)15(17)18)9-20-12-5-3-11(16)4-6-12/h2-8H,9H2,1H3,(H3,17,18) |
| InChIKey | UVAGHZOHIMCCGJ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.82 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|