C17H20N2OS — CID 65340490
5-[(2,5-dimethylphenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide (PubChem CID 65340490) has the molecular formula C17H20N2OS and a molecular weight of 300.43 g/mol. Its IUPAC name is 5-[(2,5-dimethylphenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 5-[(2,5-dimethylphenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 65340490 |
| Molecular Formula | C17H20N2OS |
| Molecular Weight | 300.43 g/mol |
| Exact Mass | 300.13 |
| IUPAC Name | 5-[(2,5-dimethylphenyl)sulfanylmethyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(CSc2cc(C)ccc2C)ccc1OC |
| InChI | InChI=1S/C17H20N2OS/c1-11-4-5-12(2)16(8-11)21-10-13-6-7-15(20-3)14(9-13)17(18)19/h4-9H,10H2,1-3H3,(H3,18,19) |
| InChIKey | LGPBXMCEKUNYRL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.43 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|