C16H23N3O2 — CID 106790876
4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzenecarboximidamide (PubChem CID 106790876) has the molecular formula C16H23N3O2 and a molecular weight of 289.38 g/mol. Its IUPAC name is 4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzenecarboximidamide.
| Compound Name | 4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzenecarboximidamide |
|---|---|
| PubChem CID | 106790876 |
| Molecular Formula | C16H23N3O2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.18 |
| IUPAC Name | 4-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(CN2C3CCC2CC(O)C3)cc1OC |
| InChI | InChI=1S/C16H23N3O2/c1-21-15-6-10(2-5-14(15)16(17)18)9-19-11-3-4-12(19)8-13(20)7-11/h2,5-6,11-13,20H,3-4,7-9H2,1H3,(H3,17,18) |
| InChIKey | NESPCNFKAHGFDA-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|