C16H20N2O2 — CID 65344235
5-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzonitrile (PubChem CID 65344235) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 5-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzonitrile.
| Compound Name | 5-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzonitrile |
|---|---|
| PubChem CID | 65344235 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 5-[(3-hydroxy-8-azabicyclo[3.2.1]octan-8-yl)methyl]-2-methoxybenzonitrile |
| SMILES | COc1ccc(CN2C3CCC2CC(O)C3)cc1C#N |
| InChI | InChI=1S/C16H20N2O2/c1-20-16-5-2-11(6-12(16)9-17)10-18-13-3-4-14(18)8-15(19)7-13/h2,5-6,13-15,19H,3-4,7-8,10H2,1H3 |
| InChIKey | RPVUPICXMOYAQD-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 56.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |