C15H16FN3O2 — CID 116626557
1-[(3-fluoro-5-nitrophenyl)methyl]-2-methyl-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 116626557) has the molecular formula C15H16FN3O2 and a molecular weight of 289.31 g/mol. Its IUPAC name is 1-[(3-fluoro-5-nitrophenyl)methyl]-2-methyl-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1-[(3-fluoro-5-nitrophenyl)methyl]-2-methyl-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 116626557 |
| Molecular Formula | C15H16FN3O2 |
| Molecular Weight | 289.31 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | 1-[(3-fluoro-5-nitrophenyl)methyl]-2-methyl-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | Cc1nc2c(n1Cc1cc(F)cc([N+](=O)[O-])c1)CCCC2 |
| InChI | InChI=1S/C15H16FN3O2/c1-10-17-14-4-2-3-5-15(14)18(10)9-11-6-12(16)8-13(7-11)19(20)21/h6-8H,2-5,9H2,1H3 |
| InChIKey | WYETTYRBPJYYQB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 60.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|