C18H20F3N3O3 — CID 71906853
1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydrobenzimidazole (PubChem CID 71906853) has the molecular formula C18H20F3N3O3 and a molecular weight of 383.37 g/mol. Its IUPAC name is 1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydrobenzimidazole.
| Compound Name | 1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydrobenzimidazole |
|---|---|
| PubChem CID | 71906853 |
| Molecular Formula | C18H20F3N3O3 |
| Molecular Weight | 383.37 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | 1-[(5-nitro-2-propan-2-yloxyphenyl)methyl]-2-(trifluoromethyl)-4,5,6,7-tetrahydrobenzimidazole |
| SMILES | CC(C)Oc1ccc([N+](=O)[O-])cc1Cn1c(C(F)(F)F)nc2c1CCCC2 |
| InChI | InChI=1S/C18H20F3N3O3/c1-11(2)27-16-8-7-13(24(25)26)9-12(16)10-23-15-6-4-3-5-14(15)22-17(23)18(19,20)21/h7-9,11H,3-6,10H2,1-2H3 |
| InChIKey | UCIKITWNWWMMHP-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.37 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|