5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid

C13H13FN2O2 — CID 107880972

IUPAC5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid
SMILESCc1ncn(Cc2ccc(F)c(C(=O)O)c2)c1C
InChIInChI=1S/C13H13FN2O2/c1-8-9(2)16(7-15-8)6-10-3-4-12(14)11(5-10)13(17)18/h3-5,7H,6H2,1-2H3,(H,17,18)
InChIKeySVWYLCFSUSQHER-UHFFFAOYSA-N
MW248.26 g/mol
LogP2.39
Rot. Bonds3

About 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid

5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid (PubChem CID 107880972) has the molecular formula C13H13FN2O2 and a molecular weight of 248.26 g/mol. Its IUPAC name is 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid.

Molecular Properties

Compound Name5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid
PubChem CID107880972
Molecular FormulaC13H13FN2O2
Molecular Weight248.26 g/mol
Exact Mass248.10
IUPAC Name5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid
SMILESCc1ncn(Cc2ccc(F)c(C(=O)O)c2)c1C
InChIInChI=1S/C13H13FN2O2/c1-8-9(2)16(7-15-8)6-10-3-4-12(14)11(5-10)13(17)18/h3-5,7H,6H2,1-2H3,(H,17,18)
InChIKeySVWYLCFSUSQHER-UHFFFAOYSA-N
XLogP2.39
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500248.26
LogP ≤ 52.39
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid?
The IUPAC name of 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid (CID 107880972) is 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid.
What is the SMILES notation for 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid?
The canonical SMILES for 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid is Cc1ncn(Cc2ccc(F)c(C(=O)O)c2)c1C.
What is the InChIKey of 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid?
The InChIKey is SVWYLCFSUSQHER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13FN2O2/c1-8-9(2)16(7-15-8)6-10-3-4-12(14)11(5-10)13(17)18/h3-5,7H,6H2,1-2H3,(H,17,18).
What are the key properties of 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid?
5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid has a molecular weight of 248.26 g/mol, XLogP of 2.39, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(4,5-dimethylimidazol-1-yl)methyl]-2-fluorobenzoic acid is sourced from PubChem (CID 107880972), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).