About 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole
1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole (PubChem CID 115641222) has the molecular formula C14H18N2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole.
Molecular Properties
| Compound Name | 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole |
| PubChem CID | 115641222 |
| Molecular Formula | C14H18N2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.15 |
| IUPAC Name | 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole |
| SMILES | Cc1cccc(C)c1Cn1cnc(C)c1C |
| InChI | InChI=1S/C14H18N2/c1-10-6-5-7-11(2)14(10)8-16-9-15-12(3)13(16)4/h5-7,9H,8H2,1-4H3 |
| InChIKey | LAKXZKFSHSAJCB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole?
The IUPAC name of 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole (CID 115641222) is 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole.
What is the SMILES notation for 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole?
The canonical SMILES for 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole is Cc1cccc(C)c1Cn1cnc(C)c1C.
What is the InChIKey of 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole?
The InChIKey is LAKXZKFSHSAJCB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2/c1-10-6-5-7-11(2)14(10)8-16-9-15-12(3)13(16)4/h5-7,9H,8H2,1-4H3.
What are the key properties of 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole?
1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole has a molecular weight of 214.31 g/mol, XLogP of 3.17, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,6-dimethylphenyl)methyl]-4,5-dimethylimidazole is sourced from PubChem (CID 115641222), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).