About 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole
1-[(2,4,6-trimethylphenyl)methyl]benzimidazole (PubChem CID 955210) has the molecular formula C17H18N2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole.
Molecular Properties
| Compound Name | 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole |
| PubChem CID | 955210 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole |
| SMILES | Cc1cc(C)c(Cn2cnc3ccccc32)c(C)c1 |
| InChI | InChI=1S/C17H18N2/c1-12-8-13(2)15(14(3)9-12)10-19-11-18-16-6-4-5-7-17(16)19/h4-9,11H,10H2,1-3H3 |
| InChIKey | KLWNFSRERRMVFY-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole?
The IUPAC name of 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole (CID 955210) is 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole.
What is the SMILES notation for 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole?
The canonical SMILES for 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole is Cc1cc(C)c(Cn2cnc3ccccc32)c(C)c1.
What is the InChIKey of 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole?
The InChIKey is KLWNFSRERRMVFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2/c1-12-8-13(2)15(14(3)9-12)10-19-11-18-16-6-4-5-7-17(16)19/h4-9,11H,10H2,1-3H3.
What are the key properties of 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole?
1-[(2,4,6-trimethylphenyl)methyl]benzimidazole has a molecular weight of 250.34 g/mol, XLogP of 4.01, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2,4,6-trimethylphenyl)methyl]benzimidazole is sourced from PubChem (CID 955210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).