About 1-benzylbenzimidazole
1-benzylbenzimidazole (PubChem CID 563347) has the molecular formula C14H12N2
and a molecular weight of 208.26 g/mol. Its IUPAC name is 1-benzylbenzimidazole.
Molecular Properties
| Compound Name | 1-benzylbenzimidazole |
| PubChem CID | 563347 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 1-benzylbenzimidazole |
| SMILES | c1ccc(Cn2cnc3ccccc32)cc1 |
| InChI | InChI=1S/C14H12N2/c1-2-6-12(7-3-1)10-16-11-15-13-8-4-5-9-14(13)16/h1-9,11H,10H2 |
| InChIKey | MNEIJGDSFRHGMS-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-benzylbenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzylbenzimidazole?
The IUPAC name of 1-benzylbenzimidazole (CID 563347) is 1-benzylbenzimidazole.
What is the SMILES notation for 1-benzylbenzimidazole?
The canonical SMILES for 1-benzylbenzimidazole is c1ccc(Cn2cnc3ccccc32)cc1.
What is the InChIKey of 1-benzylbenzimidazole?
The InChIKey is MNEIJGDSFRHGMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2/c1-2-6-12(7-3-1)10-16-11-15-13-8-4-5-9-14(13)16/h1-9,11H,10H2.
What are the key properties of 1-benzylbenzimidazole?
1-benzylbenzimidazole has a molecular weight of 208.26 g/mol, XLogP of 3.08, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzylbenzimidazole is sourced from PubChem (CID 563347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).