C11H11BrClN3 — CID 107085916
1-[2-(bromomethyl)-5-chlorophenyl]-3,5-dimethyl-1,2,4-triazole (PubChem CID 107085916) has the molecular formula C11H11BrClN3 and a molecular weight of 300.59 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-5-chlorophenyl]-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 1-[2-(bromomethyl)-5-chlorophenyl]-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 107085916 |
| Molecular Formula | C11H11BrClN3 |
| Molecular Weight | 300.59 g/mol |
| Exact Mass | 298.98 |
| IUPAC Name | 1-[2-(bromomethyl)-5-chlorophenyl]-3,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C)n(-c2cc(Cl)ccc2CBr)n1 |
| InChI | InChI=1S/C11H11BrClN3/c1-7-14-8(2)16(15-7)11-5-10(13)4-3-9(11)6-12/h3-5H,6H2,1-2H3 |
| InChIKey | FVJUDRNDHOWVNN-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.59 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|