C10H11ClN4 — CID 105067558
4-(chloromethyl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)pyridine (PubChem CID 105067558) has the molecular formula C10H11ClN4 and a molecular weight of 222.68 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)pyridine.
| Compound Name | 4-(chloromethyl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)pyridine |
|---|---|
| PubChem CID | 105067558 |
| Molecular Formula | C10H11ClN4 |
| Molecular Weight | 222.68 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-(chloromethyl)-3-(3,5-dimethyl-1,2,4-triazol-1-yl)pyridine |
| SMILES | Cc1nc(C)n(-c2cnccc2CCl)n1 |
| InChI | InChI=1S/C10H11ClN4/c1-7-13-8(2)15(14-7)10-6-12-4-3-9(10)5-11/h3-4,6H,5H2,1-2H3 |
| InChIKey | ARTFGDJDTNRYTQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.68 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|