C13H19ClN2 — CID 105067424
4-(chloromethyl)-3-(2,3-dimethylpiperidin-1-yl)pyridine (PubChem CID 105067424) has the molecular formula C13H19ClN2 and a molecular weight of 238.76 g/mol. Its IUPAC name is 4-(chloromethyl)-3-(2,3-dimethylpiperidin-1-yl)pyridine.
| Compound Name | 4-(chloromethyl)-3-(2,3-dimethylpiperidin-1-yl)pyridine |
|---|---|
| PubChem CID | 105067424 |
| Molecular Formula | C13H19ClN2 |
| Molecular Weight | 238.76 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | 4-(chloromethyl)-3-(2,3-dimethylpiperidin-1-yl)pyridine |
| SMILES | CC1CCCN(c2cnccc2CCl)C1C |
| InChI | InChI=1S/C13H19ClN2/c1-10-4-3-7-16(11(10)2)13-9-15-6-5-12(13)8-14/h5-6,9-11H,3-4,7-8H2,1-2H3 |
| InChIKey | IWSLRCNBAXZNDZ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.76 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|