C14H20ClN — CID 62123401
1-[4-(chloromethyl)phenyl]-2,3-dimethylpiperidine (PubChem CID 62123401) has the molecular formula C14H20ClN and a molecular weight of 237.77 g/mol. Its IUPAC name is 1-[4-(chloromethyl)phenyl]-2,3-dimethylpiperidine.
| Compound Name | 1-[4-(chloromethyl)phenyl]-2,3-dimethylpiperidine |
|---|---|
| PubChem CID | 62123401 |
| Molecular Formula | C14H20ClN |
| Molecular Weight | 237.77 g/mol |
| Exact Mass | 237.13 |
| IUPAC Name | 1-[4-(chloromethyl)phenyl]-2,3-dimethylpiperidine |
| SMILES | CC1CCCN(c2ccc(CCl)cc2)C1C |
| InChI | InChI=1S/C14H20ClN/c1-11-4-3-9-16(12(11)2)14-7-5-13(10-15)6-8-14/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | NAKZHVBPNJYSTJ-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.77 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|