C12H18N2OS — CID 105066979
[3-(2,3-dimethylthiomorpholin-4-yl)-4-pyridinyl]methanol (PubChem CID 105066979) has the molecular formula C12H18N2OS and a molecular weight of 238.36 g/mol. Its IUPAC name is [3-(2,3-dimethylthiomorpholin-4-yl)-4-pyridinyl]methanol.
| Compound Name | [3-(2,3-dimethylthiomorpholin-4-yl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105066979 |
| Molecular Formula | C12H18N2OS |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | [3-(2,3-dimethylthiomorpholin-4-yl)-4-pyridinyl]methanol |
| SMILES | CC1SCCN(c2cnccc2CO)C1C |
| InChI | InChI=1S/C12H18N2OS/c1-9-10(2)16-6-5-14(9)12-7-13-4-3-11(12)8-15/h3-4,7,9-10,15H,5-6,8H2,1-2H3 |
| InChIKey | WPONQAPCPBDVRT-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |