C14H18N2OS — CID 114063496
2-(2,3-dimethylthiomorpholin-4-yl)-5-(hydroxymethyl)benzonitrile (PubChem CID 114063496) has the molecular formula C14H18N2OS and a molecular weight of 262.38 g/mol. Its IUPAC name is 2-(2,3-dimethylthiomorpholin-4-yl)-5-(hydroxymethyl)benzonitrile.
| Compound Name | 2-(2,3-dimethylthiomorpholin-4-yl)-5-(hydroxymethyl)benzonitrile |
|---|---|
| PubChem CID | 114063496 |
| Molecular Formula | C14H18N2OS |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-(2,3-dimethylthiomorpholin-4-yl)-5-(hydroxymethyl)benzonitrile |
| SMILES | CC1SCCN(c2ccc(CO)cc2C#N)C1C |
| InChI | InChI=1S/C14H18N2OS/c1-10-11(2)18-6-5-16(10)14-4-3-12(9-17)7-13(14)8-15/h3-4,7,10-11,17H,5-6,9H2,1-2H3 |
| InChIKey | ZOSKIVZYQVDYTR-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|