C13H17Cl2NS — CID 114846834
4-[5-chloro-2-(chloromethyl)phenyl]-2,3-dimethylthiomorpholine (PubChem CID 114846834) has the molecular formula C13H17Cl2NS and a molecular weight of 290.26 g/mol. Its IUPAC name is 4-[5-chloro-2-(chloromethyl)phenyl]-2,3-dimethylthiomorpholine.
| Compound Name | 4-[5-chloro-2-(chloromethyl)phenyl]-2,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 114846834 |
| Molecular Formula | C13H17Cl2NS |
| Molecular Weight | 290.26 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 4-[5-chloro-2-(chloromethyl)phenyl]-2,3-dimethylthiomorpholine |
| SMILES | CC1SCCN(c2cc(Cl)ccc2CCl)C1C |
| InChI | InChI=1S/C13H17Cl2NS/c1-9-10(2)17-6-5-16(9)13-7-12(15)4-3-11(13)8-14/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | ZBGZECNVNLLIGH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.26 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|