C12H15BrClNS — CID 107083869
4-[2-(bromomethyl)-5-chlorophenyl]-3-methylthiomorpholine (PubChem CID 107083869) has the molecular formula C12H15BrClNS and a molecular weight of 320.68 g/mol. Its IUPAC name is 4-[2-(bromomethyl)-5-chlorophenyl]-3-methylthiomorpholine.
| Compound Name | 4-[2-(bromomethyl)-5-chlorophenyl]-3-methylthiomorpholine |
|---|---|
| PubChem CID | 107083869 |
| Molecular Formula | C12H15BrClNS |
| Molecular Weight | 320.68 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 4-[2-(bromomethyl)-5-chlorophenyl]-3-methylthiomorpholine |
| SMILES | CC1CSCCN1c1cc(Cl)ccc1CBr |
| InChI | InChI=1S/C12H15BrClNS/c1-9-8-16-5-4-15(9)12-6-11(14)3-2-10(12)7-13/h2-3,6,9H,4-5,7-8H2,1H3 |
| InChIKey | MPNCMYVESHBOAL-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|