C11H14Cl2N2S — CID 106890449
3,5-dichloro-4-(3-methylthiomorpholin-4-yl)aniline (PubChem CID 106890449) has the molecular formula C11H14Cl2N2S and a molecular weight of 277.22 g/mol. Its IUPAC name is 3,5-dichloro-4-(3-methylthiomorpholin-4-yl)aniline.
| Compound Name | 3,5-dichloro-4-(3-methylthiomorpholin-4-yl)aniline |
|---|---|
| PubChem CID | 106890449 |
| Molecular Formula | C11H14Cl2N2S |
| Molecular Weight | 277.22 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 3,5-dichloro-4-(3-methylthiomorpholin-4-yl)aniline |
| SMILES | CC1CSCCN1c1c(Cl)cc(N)cc1Cl |
| InChI | InChI=1S/C11H14Cl2N2S/c1-7-6-16-3-2-15(7)11-9(12)4-8(14)5-10(11)13/h4-5,7H,2-3,6,14H2,1H3 |
| InChIKey | NGIWBUAHBZFVHI-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.22 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|