C14H19BrClN — CID 107084249
1-[2-(bromomethyl)-4-chlorophenyl]-2,5-dimethylpiperidine (PubChem CID 107084249) has the molecular formula C14H19BrClN and a molecular weight of 316.67 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-4-chlorophenyl]-2,5-dimethylpiperidine.
| Compound Name | 1-[2-(bromomethyl)-4-chlorophenyl]-2,5-dimethylpiperidine |
|---|---|
| PubChem CID | 107084249 |
| Molecular Formula | C14H19BrClN |
| Molecular Weight | 316.67 g/mol |
| Exact Mass | 315.04 |
| IUPAC Name | 1-[2-(bromomethyl)-4-chlorophenyl]-2,5-dimethylpiperidine |
| SMILES | CC1CCC(C)N(c2ccc(Cl)cc2CBr)C1 |
| InChI | InChI=1S/C14H19BrClN/c1-10-3-4-11(2)17(9-10)14-6-5-13(16)7-12(14)8-15/h5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | FCDKFZYTIAQRCS-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.67 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|