About 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine
1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine (PubChem CID 107084241) has the molecular formula C15H19BrF3N
and a molecular weight of 350.22 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine.
Molecular Properties
| Compound Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine |
| PubChem CID | 107084241 |
| Molecular Formula | C15H19BrF3N |
| Molecular Weight | 350.22 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine |
| SMILES | CC1CCC(C)N(c2ccc(CBr)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H19BrF3N/c1-10-3-4-11(2)20(9-10)14-6-5-12(8-16)7-13(14)15(17,18)19/h5-7,10-11H,3-4,8-9H2,1-2H3 |
| InChIKey | FEJFSFRAOSYNAD-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 350.22 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine?
The IUPAC name of 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine (CID 107084241) is 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine.
What is the SMILES notation for 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine?
The canonical SMILES for 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine is CC1CCC(C)N(c2ccc(CBr)cc2C(F)(F)F)C1.
What is the InChIKey of 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine?
The InChIKey is FEJFSFRAOSYNAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19BrF3N/c1-10-3-4-11(2)20(9-10)14-6-5-12(8-16)7-13(14)15(17,18)19/h5-7,10-11H,3-4,8-9H2,1-2H3.
What are the key properties of 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine?
1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine has a molecular weight of 350.22 g/mol, XLogP of 5.23, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-2,5-dimethylpiperidine is sourced from PubChem (CID 107084241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).