C14H19N3O — CID 114087404
2-(2,4-dimethylpiperazin-1-yl)-5-(hydroxymethyl)benzonitrile (PubChem CID 114087404) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 2-(2,4-dimethylpiperazin-1-yl)-5-(hydroxymethyl)benzonitrile.
| Compound Name | 2-(2,4-dimethylpiperazin-1-yl)-5-(hydroxymethyl)benzonitrile |
|---|---|
| PubChem CID | 114087404 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 2-(2,4-dimethylpiperazin-1-yl)-5-(hydroxymethyl)benzonitrile |
| SMILES | CC1CN(C)CCN1c1ccc(CO)cc1C#N |
| InChI | InChI=1S/C14H19N3O/c1-11-9-16(2)5-6-17(11)14-4-3-12(10-18)7-13(14)8-15/h3-4,7,11,18H,5-6,9-10H2,1-2H3 |
| InChIKey | PLDKZYMQGJIDAH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 50.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|