C18H17BrClN3 — CID 59262016
5-bromo-2-[(2R)-2-(4-chlorophenyl)-4-methylpiperazin-1-yl]benzonitrile (PubChem CID 59262016) has the molecular formula C18H17BrClN3 and a molecular weight of 390.71 g/mol. Its IUPAC name is 5-bromo-2-[(2R)-2-(4-chlorophenyl)-4-methylpiperazin-1-yl]benzonitrile.
| Compound Name | 5-bromo-2-[(2R)-2-(4-chlorophenyl)-4-methylpiperazin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 59262016 |
| Molecular Formula | C18H17BrClN3 |
| Molecular Weight | 390.71 g/mol |
| Exact Mass | 389.03 |
| IUPAC Name | 5-bromo-2-[(2R)-2-(4-chlorophenyl)-4-methylpiperazin-1-yl]benzonitrile |
| SMILES | CN1CCN(c2ccc(Br)cc2C#N)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C18H17BrClN3/c1-22-8-9-23(17-7-4-15(19)10-14(17)11-21)18(12-22)13-2-5-16(20)6-3-13/h2-7,10,18H,8-9,12H2,1H3/t18-/m0/s1 |
| InChIKey | GGPPRRYYQZEUFB-SFHVURJKSA-N |
| XLogP | 4.47 |
| TPSA | 30.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.71 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |