C17H20BrN3 — CID 65341789
4-bromo-2-(4-methyl-2-phenylpiperazin-1-yl)aniline (PubChem CID 65341789) has the molecular formula C17H20BrN3 and a molecular weight of 346.27 g/mol. Its IUPAC name is 4-bromo-2-(4-methyl-2-phenylpiperazin-1-yl)aniline.
| Compound Name | 4-bromo-2-(4-methyl-2-phenylpiperazin-1-yl)aniline |
|---|---|
| PubChem CID | 65341789 |
| Molecular Formula | C17H20BrN3 |
| Molecular Weight | 346.27 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 4-bromo-2-(4-methyl-2-phenylpiperazin-1-yl)aniline |
| SMILES | CN1CCN(c2cc(Br)ccc2N)C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H20BrN3/c1-20-9-10-21(16-11-14(18)7-8-15(16)19)17(12-20)13-5-3-2-4-6-13/h2-8,11,17H,9-10,12,19H2,1H3 |
| InChIKey | DWQQHQYXNNLUID-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.27 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|