C12H18N2O — CID 105066909
[3-(3,4-dimethylpyrrolidin-1-yl)-4-pyridinyl]methanol (PubChem CID 105066909) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is [3-(3,4-dimethylpyrrolidin-1-yl)-4-pyridinyl]methanol.
| Compound Name | [3-(3,4-dimethylpyrrolidin-1-yl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105066909 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | [3-(3,4-dimethylpyrrolidin-1-yl)-4-pyridinyl]methanol |
| SMILES | CC1CN(c2cnccc2CO)CC1C |
| InChI | InChI=1S/C12H18N2O/c1-9-6-14(7-10(9)2)12-5-13-4-3-11(12)8-15/h3-5,9-10,15H,6-8H2,1-2H3 |
| InChIKey | PWYYRDVKEXZURM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |