C18H22N2O — CID 105066691
[3-(4-benzylpiperidin-1-yl)-4-pyridinyl]methanol (PubChem CID 105066691) has the molecular formula C18H22N2O and a molecular weight of 282.39 g/mol. Its IUPAC name is [3-(4-benzylpiperidin-1-yl)-4-pyridinyl]methanol.
| Compound Name | [3-(4-benzylpiperidin-1-yl)-4-pyridinyl]methanol |
|---|---|
| PubChem CID | 105066691 |
| Molecular Formula | C18H22N2O |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.17 |
| IUPAC Name | [3-(4-benzylpiperidin-1-yl)-4-pyridinyl]methanol |
| SMILES | OCc1ccncc1N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C18H22N2O/c21-14-17-6-9-19-13-18(17)20-10-7-16(8-11-20)12-15-4-2-1-3-5-15/h1-6,9,13,16,21H,7-8,10-12,14H2 |
| InChIKey | PYNDEKKOENGOOR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |