C14H21N3S — CID 105073996
N-[[3-(3-methylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 105073996) has the molecular formula C14H21N3S and a molecular weight of 263.41 g/mol. Its IUPAC name is N-[[3-(3-methylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(3-methylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105073996 |
| Molecular Formula | C14H21N3S |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | N-[[3-(3-methylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CC1CSCCN1c1cnccc1CNC1CC1 |
| InChI | InChI=1S/C14H21N3S/c1-11-10-18-7-6-17(11)14-9-15-5-4-12(14)8-16-13-2-3-13/h4-5,9,11,13,16H,2-3,6-8,10H2,1H3 |
| InChIKey | CKBNJILGUBMWBQ-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |