C14H21N3O2S2 — CID 105074134
N-[[3-(3-methylsulfonylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 105074134) has the molecular formula C14H21N3O2S2 and a molecular weight of 327.48 g/mol. Its IUPAC name is N-[[3-(3-methylsulfonylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[3-(3-methylsulfonylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 105074134 |
| Molecular Formula | C14H21N3O2S2 |
| Molecular Weight | 327.48 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | N-[[3-(3-methylsulfonylthiomorpholin-4-yl)-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CS(=O)(=O)C1CSCCN1c1cnccc1CNC1CC1 |
| InChI | InChI=1S/C14H21N3O2S2/c1-21(18,19)14-10-20-7-6-17(14)13-9-15-5-4-11(13)8-16-12-2-3-12/h4-5,9,12,14,16H,2-3,6-8,10H2,1H3 |
| InChIKey | ABROIXXYIYMICV-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.48 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |