C12H17ClN2O — CID 105067324
4-[4-(chloromethyl)-3-pyridinyl]-2,2-dimethylmorpholine (PubChem CID 105067324) has the molecular formula C12H17ClN2O and a molecular weight of 240.73 g/mol. Its IUPAC name is 4-[4-(chloromethyl)-3-pyridinyl]-2,2-dimethylmorpholine.
| Compound Name | 4-[4-(chloromethyl)-3-pyridinyl]-2,2-dimethylmorpholine |
|---|---|
| PubChem CID | 105067324 |
| Molecular Formula | C12H17ClN2O |
| Molecular Weight | 240.73 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 4-[4-(chloromethyl)-3-pyridinyl]-2,2-dimethylmorpholine |
| SMILES | CC1(C)CN(c2cnccc2CCl)CCO1 |
| InChI | InChI=1S/C12H17ClN2O/c1-12(2)9-15(5-6-16-12)11-8-14-4-3-10(11)7-13/h3-4,8H,5-7,9H2,1-2H3 |
| InChIKey | IAXBGEOPKCYDBY-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.73 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|