C12H11BrF3N3 — CID 107085926
1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-3,5-dimethyl-1,2,4-triazole (PubChem CID 107085926) has the molecular formula C12H11BrF3N3 and a molecular weight of 334.14 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-3,5-dimethyl-1,2,4-triazole.
| Compound Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-3,5-dimethyl-1,2,4-triazole |
|---|---|
| PubChem CID | 107085926 |
| Molecular Formula | C12H11BrF3N3 |
| Molecular Weight | 334.14 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-3,5-dimethyl-1,2,4-triazole |
| SMILES | Cc1nc(C)n(-c2ccc(CBr)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C12H11BrF3N3/c1-7-17-8(2)19(18-7)11-4-3-9(6-13)5-10(11)12(14,15)16/h3-5H,6H2,1-2H3 |
| InChIKey | NIZAIVLULRRBLC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.14 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|