C16H21BrF3N — CID 107083242
1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-4-ethyl-4-methylpiperidine (PubChem CID 107083242) has the molecular formula C16H21BrF3N and a molecular weight of 364.25 g/mol. Its IUPAC name is 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-4-ethyl-4-methylpiperidine.
| Compound Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-4-ethyl-4-methylpiperidine |
|---|---|
| PubChem CID | 107083242 |
| Molecular Formula | C16H21BrF3N |
| Molecular Weight | 364.25 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 1-[4-(bromomethyl)-2-(trifluoromethyl)phenyl]-4-ethyl-4-methylpiperidine |
| SMILES | CCC1(C)CCN(c2ccc(CBr)cc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C16H21BrF3N/c1-3-15(2)6-8-21(9-7-15)14-5-4-12(11-17)10-13(14)16(18,19)20/h4-5,10H,3,6-9,11H2,1-2H3 |
| InChIKey | OKBZTBJZWSTRRL-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.25 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|