C14H21ClN4 — CID 114924960
N-[[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]cyclopropanamine (PubChem CID 114924960) has the molecular formula C14H21ClN4 and a molecular weight of 280.80 g/mol. Its IUPAC name is N-[[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]cyclopropanamine.
| Compound Name | N-[[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 114924960 |
| Molecular Formula | C14H21ClN4 |
| Molecular Weight | 280.80 g/mol |
| Exact Mass | 280.15 |
| IUPAC Name | N-[[5-chloro-2-(4-methylpiperazin-1-yl)-4-pyridinyl]methyl]cyclopropanamine |
| SMILES | CN1CCN(c2cc(CNC3CC3)c(Cl)cn2)CC1 |
| InChI | InChI=1S/C14H21ClN4/c1-18-4-6-19(7-5-18)14-8-11(13(15)10-17-14)9-16-12-2-3-12/h8,10,12,16H,2-7,9H2,1H3 |
| InChIKey | HHTHHLDLAILTAX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.80 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |