C6H4ClN5 — CID 77231195
2-chloro-5-(1,2,4-triazol-1-yl)pyrazine (PubChem CID 77231195) has the molecular formula C6H4ClN5 and a molecular weight of 181.59 g/mol. Its IUPAC name is 2-chloro-5-(1,2,4-triazol-1-yl)pyrazine.
| Compound Name | 2-chloro-5-(1,2,4-triazol-1-yl)pyrazine |
|---|---|
| PubChem CID | 77231195 |
| Molecular Formula | C6H4ClN5 |
| Molecular Weight | 181.59 g/mol |
| Exact Mass | 181.02 |
| IUPAC Name | 2-chloro-5-(1,2,4-triazol-1-yl)pyrazine |
| SMILES | Clc1cnc(-n2cncn2)cn1 |
| InChI | InChI=1S/C6H4ClN5/c7-5-1-10-6(2-9-5)12-4-8-3-11-12/h1-4H |
| InChIKey | CTVUIWBGHKLMDA-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |