C11H11N5 — CID 141185839
N-cyclopropyl-6-pyrimidin-5-ylpyrimidin-4-amine (PubChem CID 141185839) has the molecular formula C11H11N5 and a molecular weight of 213.24 g/mol. Its IUPAC name is N-cyclopropyl-6-pyrimidin-5-ylpyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-pyrimidin-5-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 141185839 |
| Molecular Formula | C11H11N5 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | N-cyclopropyl-6-pyrimidin-5-ylpyrimidin-4-amine |
| SMILES | c1ncc(-c2cc(NC3CC3)ncn2)cn1 |
| InChI | InChI=1S/C11H11N5/c1-2-9(1)16-11-3-10(14-7-15-11)8-4-12-6-13-5-8/h3-7,9H,1-2H2,(H,14,15,16) |
| InChIKey | JZAMUGWUTGFHKD-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |