C14H15N3S — CID 82483168
N-cyclopropyl-6-(4-methylsulfanylphenyl)pyrimidin-4-amine (PubChem CID 82483168) has the molecular formula C14H15N3S and a molecular weight of 257.36 g/mol. Its IUPAC name is N-cyclopropyl-6-(4-methylsulfanylphenyl)pyrimidin-4-amine.
| Compound Name | N-cyclopropyl-6-(4-methylsulfanylphenyl)pyrimidin-4-amine |
|---|---|
| PubChem CID | 82483168 |
| Molecular Formula | C14H15N3S |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.10 |
| IUPAC Name | N-cyclopropyl-6-(4-methylsulfanylphenyl)pyrimidin-4-amine |
| SMILES | CSc1ccc(-c2cc(NC3CC3)ncn2)cc1 |
| InChI | InChI=1S/C14H15N3S/c1-18-12-6-2-10(3-7-12)13-8-14(16-9-15-13)17-11-4-5-11/h2-3,6-9,11H,4-5H2,1H3,(H,15,16,17) |
| InChIKey | BUAQCUHROBSMRT-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |