C19H20F4N4O — CID 139574214
N-[4-[[6-[3-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]cyclohexyl]acetamide (PubChem CID 139574214) has the molecular formula C19H20F4N4O and a molecular weight of 396.39 g/mol. Its IUPAC name is N-[4-[[6-[3-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]cyclohexyl]acetamide.
| Compound Name | N-[4-[[6-[3-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]cyclohexyl]acetamide |
|---|---|
| PubChem CID | 139574214 |
| Molecular Formula | C19H20F4N4O |
| Molecular Weight | 396.39 g/mol |
| Exact Mass | 396.16 |
| IUPAC Name | N-[4-[[6-[3-fluoro-4-(trifluoromethyl)phenyl]pyrimidin-4-yl]amino]cyclohexyl]acetamide |
| SMILES | CC(=O)NC1CCC(Nc2cc(-c3ccc(C(F)(F)F)c(F)c3)ncn2)CC1 |
| InChI | InChI=1S/C19H20F4N4O/c1-11(28)26-13-3-5-14(6-4-13)27-18-9-17(24-10-25-18)12-2-7-15(16(20)8-12)19(21,22)23/h2,7-10,13-14H,3-6H2,1H3,(H,26,28)(H,24,25,27) |
| InChIKey | KSBSMKBOQODNPU-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.39 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |