C21H19NO3S2 — CID 143906913
(3Z)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)penta-1,3-diene-2-sulfonamide (PubChem CID 143906913) has the molecular formula C21H19NO3S2 and a molecular weight of 397.52 g/mol. Its IUPAC name is (3Z)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)penta-1,3-diene-2-sulfonamide.
| Compound Name | (3Z)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)penta-1,3-diene-2-sulfonamide |
|---|---|
| PubChem CID | 143906913 |
| Molecular Formula | C21H19NO3S2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | (3Z)-N-(4-hydroxy-3-phenylsulfanylnaphthalen-1-yl)penta-1,3-diene-2-sulfonamide |
| SMILES | C=C(/C=C\C)S(=O)(=O)Nc1cc(Sc2ccccc2)c(O)c2ccccc12 |
| InChI | InChI=1S/C21H19NO3S2/c1-3-9-15(2)27(24,25)22-19-14-20(26-16-10-5-4-6-11-16)21(23)18-13-8-7-12-17(18)19/h3-14,22-23H,2H2,1H3/b9-3- |
| InChIKey | FRAACFKEGDJROP-OQFOIZHKSA-N |
| XLogP | 5.53 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|