C24H17ClN2O3S3 — CID 123407540
1-(5-chlorothiophen-2-yl)-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)methanesulfonamide (PubChem CID 123407540) has the molecular formula C24H17ClN2O3S3 and a molecular weight of 513.07 g/mol. Its IUPAC name is 1-(5-chlorothiophen-2-yl)-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)methanesulfonamide.
| Compound Name | 1-(5-chlorothiophen-2-yl)-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 123407540 |
| Molecular Formula | C24H17ClN2O3S3 |
| Molecular Weight | 513.07 g/mol |
| Exact Mass | 512.01 |
| IUPAC Name | 1-(5-chlorothiophen-2-yl)-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)methanesulfonamide |
| SMILES | O=S(=O)(Cc1ccc(Cl)s1)Nc1cc(Sc2cccc3cccnc23)c(O)c2ccccc12 |
| InChI | InChI=1S/C24H17ClN2O3S3/c25-22-11-10-16(31-22)14-33(29,30)27-19-13-21(24(28)18-8-2-1-7-17(18)19)32-20-9-3-5-15-6-4-12-26-23(15)20/h1-13,27-28H,14H2 |
| InChIKey | CFQLOKXDJHPYCR-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.07 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|