C27H22N2O4S2 — CID 58565699
2-ethoxy-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide (PubChem CID 58565699) has the molecular formula C27H22N2O4S2 and a molecular weight of 502.62 g/mol. Its IUPAC name is 2-ethoxy-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 2-ethoxy-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 58565699 |
| Molecular Formula | C27H22N2O4S2 |
| Molecular Weight | 502.62 g/mol |
| Exact Mass | 502.10 |
| IUPAC Name | 2-ethoxy-N-(4-hydroxy-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide |
| SMILES | CCOc1ccccc1S(=O)(=O)Nc1cc(Sc2cccc3cccnc23)c(O)c2ccccc12 |
| InChI | InChI=1S/C27H22N2O4S2/c1-2-33-22-13-5-6-15-25(22)35(31,32)29-21-17-24(27(30)20-12-4-3-11-19(20)21)34-23-14-7-9-18-10-8-16-28-26(18)23/h3-17,29-30H,2H2,1H3 |
| InChIKey | CSFNWVKJSZYOFQ-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 88.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.62 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|