C33H28N2O3S2 — CID 144778813
4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-(4-methyl-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide (PubChem CID 144778813) has the molecular formula C33H28N2O3S2 and a molecular weight of 564.73 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-(4-methyl-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-(4-methyl-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 144778813 |
| Molecular Formula | C33H28N2O3S2 |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.15 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]oxy-N-(4-methyl-3-quinolin-8-ylsulfanylnaphthalen-1-yl)benzenesulfonamide |
| SMILES | C=C/C(=C\C=C/C)Oc1ccc(S(=O)(=O)Nc2cc(Sc3cccc4cccnc34)c(C)c3ccccc23)cc1 |
| InChI | InChI=1S/C33H28N2O3S2/c1-4-6-13-25(5-2)38-26-17-19-27(20-18-26)40(36,37)35-30-22-32(23(3)28-14-7-8-15-29(28)30)39-31-16-9-11-24-12-10-21-34-33(24)31/h4-22,35H,2H2,1,3H3/b6-4-,25-13+ |
| InChIKey | NXYUIZOMLNHPLZ-HTSKZVBYSA-N |
| XLogP | 8.67 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|