C20H20N4O4S2 — CID 143906891
N-[3-(2,3-dihydro-1H-1,2,4-triazol-5-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2-methoxy-5-methylbenzenesulfonamide (PubChem CID 143906891) has the molecular formula C20H20N4O4S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N-[3-(2,3-dihydro-1H-1,2,4-triazol-5-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2-methoxy-5-methylbenzenesulfonamide.
| Compound Name | N-[3-(2,3-dihydro-1H-1,2,4-triazol-5-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2-methoxy-5-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 143906891 |
| Molecular Formula | C20H20N4O4S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.09 |
| IUPAC Name | N-[3-(2,3-dihydro-1H-1,2,4-triazol-5-ylsulfanyl)-4-hydroxynaphthalen-1-yl]-2-methoxy-5-methylbenzenesulfonamide |
| SMILES | COc1ccc(C)cc1S(=O)(=O)Nc1cc(SC2=NCNN2)c(O)c2ccccc12 |
| InChI | InChI=1S/C20H20N4O4S2/c1-12-7-8-16(28-2)18(9-12)30(26,27)24-15-10-17(29-20-21-11-22-23-20)19(25)14-6-4-3-5-13(14)15/h3-10,22,24-25H,11H2,1-2H3,(H,21,23) |
| InChIKey | VMGCUESWOGNDRD-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 112.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|