C21H14N4O3S2 — CID 23882189
2-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]-2,3-dihydro-1H-quinazolin-4-one (PubChem CID 23882189) has the molecular formula C21H14N4O3S2 and a molecular weight of 434.50 g/mol. Its IUPAC name is 2-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]-2,3-dihydro-1H-quinazolin-4-one.
| Compound Name | 2-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]-2,3-dihydro-1H-quinazolin-4-one |
|---|---|
| PubChem CID | 23882189 |
| Molecular Formula | C21H14N4O3S2 |
| Molecular Weight | 434.50 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 2-[4-(1,3-benzothiazol-2-ylsulfanyl)-3-nitrophenyl]-2,3-dihydro-1H-quinazolin-4-one |
| SMILES | O=C1NC(c2ccc(Sc3nc4ccccc4s3)c([N+](=O)[O-])c2)Nc2ccccc21 |
| InChI | InChI=1S/C21H14N4O3S2/c26-20-13-5-1-2-6-14(13)22-19(24-20)12-9-10-18(16(11-12)25(27)28)30-21-23-15-7-3-4-8-17(15)29-21/h1-11,19,22H,(H,24,26) |
| InChIKey | GDQQJSLWQHVUMR-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 97.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|