C15H8N2O2S2 — CID 43586478
6-(1,3-benzothiazol-2-ylsulfanyl)-1H-indole-2,3-dione (PubChem CID 43586478) has the molecular formula C15H8N2O2S2 and a molecular weight of 312.38 g/mol. Its IUPAC name is 6-(1,3-benzothiazol-2-ylsulfanyl)-1H-indole-2,3-dione.
| Compound Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-1H-indole-2,3-dione |
|---|---|
| PubChem CID | 43586478 |
| Molecular Formula | C15H8N2O2S2 |
| Molecular Weight | 312.38 g/mol |
| Exact Mass | 312.00 |
| IUPAC Name | 6-(1,3-benzothiazol-2-ylsulfanyl)-1H-indole-2,3-dione |
| SMILES | O=C1Nc2cc(Sc3nc4ccccc4s3)ccc2C1=O |
| InChI | InChI=1S/C15H8N2O2S2/c18-13-9-6-5-8(7-11(9)16-14(13)19)20-15-17-10-3-1-2-4-12(10)21-15/h1-7H,(H,16,18,19) |
| InChIKey | FEIJPWXHAMEMOR-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|