C16H9N3O3S — CID 5240847
N-(1,3-dioxoisoindol-5-yl)-1,3-benzothiazole-2-carboxamide (PubChem CID 5240847) has the molecular formula C16H9N3O3S and a molecular weight of 323.33 g/mol. Its IUPAC name is N-(1,3-dioxoisoindol-5-yl)-1,3-benzothiazole-2-carboxamide.
| Compound Name | N-(1,3-dioxoisoindol-5-yl)-1,3-benzothiazole-2-carboxamide |
|---|---|
| PubChem CID | 5240847 |
| Molecular Formula | C16H9N3O3S |
| Molecular Weight | 323.33 g/mol |
| Exact Mass | 323.04 |
| IUPAC Name | N-(1,3-dioxoisoindol-5-yl)-1,3-benzothiazole-2-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)C(=O)NC2=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9N3O3S/c20-13-9-6-5-8(7-10(9)14(21)19-13)17-15(22)16-18-11-3-1-2-4-12(11)23-16/h1-7H,(H,17,22)(H,19,20,21) |
| InChIKey | MIXXBFHGLIDTOW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.33 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|