C20H17BrN2O3S — CID 41361138
2-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one (PubChem CID 41361138) has the molecular formula C20H17BrN2O3S and a molecular weight of 445.34 g/mol. Its IUPAC name is 2-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one.
| Compound Name | 2-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
|---|---|
| PubChem CID | 41361138 |
| Molecular Formula | C20H17BrN2O3S |
| Molecular Weight | 445.34 g/mol |
| Exact Mass | 444.01 |
| IUPAC Name | 2-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methylsulfanyl]-3-prop-2-enylquinazolin-4-one |
| SMILES | C=CCn1c(SCc2cc3c(cc2Br)OCCO3)nc2ccccc2c1=O |
| InChI | InChI=1S/C20H17BrN2O3S/c1-2-7-23-19(24)14-5-3-4-6-16(14)22-20(23)27-12-13-10-17-18(11-15(13)21)26-9-8-25-17/h2-6,10-11H,1,7-9,12H2 |
| InChIKey | OBYFDZODYGNAKG-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|