C17H14FN3O3S — CID 53490178
methyl 3-amino-2-[(4-fluorophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxylate (PubChem CID 53490178) has the molecular formula C17H14FN3O3S and a molecular weight of 359.38 g/mol. Its IUPAC name is methyl 3-amino-2-[(4-fluorophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxylate.
| Compound Name | methyl 3-amino-2-[(4-fluorophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxylate |
|---|---|
| PubChem CID | 53490178 |
| Molecular Formula | C17H14FN3O3S |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.07 |
| IUPAC Name | methyl 3-amino-2-[(4-fluorophenyl)methylsulfanyl]-4-oxoquinazoline-7-carboxylate |
| SMILES | COC(=O)c1ccc2c(=O)n(N)c(SCc3ccc(F)cc3)nc2c1 |
| InChI | InChI=1S/C17H14FN3O3S/c1-24-16(23)11-4-7-13-14(8-11)20-17(21(19)15(13)22)25-9-10-2-5-12(18)6-3-10/h2-8H,9,19H2,1H3 |
| InChIKey | UOVOHRJBMAVNJB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |